CAS 1039325-60-4 appears in our catalog under these names: 1-(2-Bromophenyl)-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(2-Bromophenyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
1-(2-bromophenyl)triazole-4-carboxylic acid (CAS 1039325-60-4) is a chemical compound with the molecular formula C9H6BrN3O2 and a molecular weight of 268.07 g/mol. IUPAC name: 1-(2-bromophenyl)triazole-4-carboxylic acid. InChIKey: HGZAJEVMCGETLV-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3O2 |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 1-(2-bromophenyl)triazole-4-carboxylic acid |
| InChIKey | HGZAJEVMCGETLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=C(N=N2)C(=O)O)Br |
Computed by PubChem (NCBI)