CAS 957034-96-7 appears in our catalog under these names: 4-Bromo-1-(2-nitrophenyl)-1H-pyrazole, 98%, 4-Bromo-1-(2-nitrophenyl)-1H-pyrazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 100g, 1g, 10g.
4-bromo-1-(2-nitrophenyl)pyrazole (CAS 957034-96-7) is a chemical compound with the molecular formula C9H6BrN3O2 and a molecular weight of 268.07 g/mol. IUPAC name: 4-bromo-1-(2-nitrophenyl)pyrazole. InChIKey: YXTFCFMLBKEZQN-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3O2 |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 4-bromo-1-(2-nitrophenyl)pyrazole |
| InChIKey | YXTFCFMLBKEZQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=C(C=N2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)