Products 2410309-63-4

CAS 2410309-63-4 is the registry number for 8-Amino-5-bromo-1,7-naphthyridine-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

8-amino-5-bromo-1,7-naphthyridine-3-carboxylic acid (CAS 2410309-63-4) is a chemical compound with the molecular formula C9H6BrN3O2 and a molecular weight of 268.07 g/mol. IUPAC name: 8-amino-5-bromo-1,7-naphthyridine-3-carboxylic acid. InChIKey: ZXTUITBIVLNADF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6BrN3O2
Molecular weight268.07 g/mol
IUPAC name8-amino-5-bromo-1,7-naphthyridine-3-carboxylic acid
InChIKeyZXTUITBIVLNADF-UHFFFAOYSA-N
SMILESC1=C(C=NC2=C1C(=CN=C2N)Br)C(=O)O

Computed by PubChem (NCBI)