Products 2691878-60-9

CAS 2691878-60-9 is the registry number for 7-Amino-6-bromo-1,8-naphthyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-amino-6-bromo-1,8-naphthyridine-3-carboxylic acid (CAS 2691878-60-9) is a chemical compound with the molecular formula C9H6BrN3O2 and a molecular weight of 268.07 g/mol. IUPAC name: 7-amino-6-bromo-1,8-naphthyridine-3-carboxylic acid. InChIKey: JMNFDQVASKIHSI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6BrN3O2
Molecular weight268.07 g/mol
IUPAC name7-amino-6-bromo-1,8-naphthyridine-3-carboxylic acid
InChIKeyJMNFDQVASKIHSI-UHFFFAOYSA-N
SMILESC1=C2C=C(C(=NC2=NC=C1C(=O)O)N)Br

Computed by PubChem (NCBI)