CAS 944901-52-4 appears in our catalog under these names: 1-(4-Bromophenyl)-1H-1,2,3-triazole-4-carboxylic acid, 1-(4-Bromophenyl)-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(4-Bromophenyl)-1H-1,2,3-triazole-4-carboxylic acid 95%. Offered by: Biosynth, Combi-blocks, Ambeed. Available pack sizes: 250mg, 2,5g, 5g, 1g, 100mg.
1-(4-bromophenyl)triazole-4-carboxylic acid (CAS 944901-52-4) is a chemical compound with the molecular formula C9H6BrN3O2 and a molecular weight of 268.07 g/mol. IUPAC name: 1-(4-bromophenyl)triazole-4-carboxylic acid. InChIKey: XTICDBQCZOQKSL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3O2 |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 1-(4-bromophenyl)triazole-4-carboxylic acid |
| InChIKey | XTICDBQCZOQKSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(N=N2)C(=O)O)Br |
Computed by PubChem (NCBI)