Products 1099687-28-1
CAS 1099687-28-1 appears in our catalog under these names: 4-Bromo-2-(1H-1,2,4-triazol-1-yl)benzoic acid, 95%, 4-Bromo-2-(1H-1,2,4-triazol-1-yl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 100mg, 1g.
4-bromo-2-(1,2,4-triazol-1-yl)benzoic acid (CAS 1099687-28-1) is a chemical compound with the molecular formula C9H6BrN3O2 and a molecular weight of 268.07 g/mol. IUPAC name: 4-bromo-2-(1,2,4-triazol-1-yl)benzoic acid. InChIKey: WTEPQFGPVWZUCL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3O2 |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 4-bromo-2-(1,2,4-triazol-1-yl)benzoic acid |
| InChIKey | WTEPQFGPVWZUCL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)N2C=NC=N2)C(=O)O |
Computed by PubChem (NCBI)