Products 1780843-50-6

CAS 1780843-50-6 is the registry number for 2-Amino-8-bromoquinazoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-8-bromoquinazoline-4-carboxylic acid (CAS 1780843-50-6) is a chemical compound with the molecular formula C9H6BrN3O2 and a molecular weight of 268.07 g/mol. IUPAC name: 2-amino-8-bromoquinazoline-4-carboxylic acid. InChIKey: SFQSEOVIDBBAJP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6BrN3O2
Molecular weight268.07 g/mol
IUPAC name2-amino-8-bromoquinazoline-4-carboxylic acid
InChIKeySFQSEOVIDBBAJP-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)Br)N=C(N=C2C(=O)O)N

Computed by PubChem (NCBI)