Products 1706454-04-7
CAS 1706454-04-7 appears in our catalog under these names: methyl 6-(aminomethyl)nicotinate dihydrochloride, 95%, Methyl 6-(aminomethyl)pyridine-3-carboxylate dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 10g.
Methyl 6-(aminomethyl)pyridine-3-carboxylate;dihydrochloride (CAS 1706454-04-7) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: methyl 6-(aminomethyl)pyridine-3-carboxylate;dihydrochloride. InChIKey: ZOHTVFSKZIUKLW-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | methyl 6-(aminomethyl)pyridine-3-carboxylate;dihydrochloride |
| InChIKey | ZOHTVFSKZIUKLW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)