Products 1039833-44-7
CAS 1039833-44-7 is the registry number for 3-(2-(Furan-2-yl)ethyl)-1,2-oxazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[2-(furan-2-yl)ethyl]-1,2-oxazol-5-amine (CAS 1039833-44-7) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 3-[2-(furan-2-yl)ethyl]-1,2-oxazol-5-amine. InChIKey: CYUVAXXVNMLOKG-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 3-[2-(furan-2-yl)ethyl]-1,2-oxazol-5-amine |
| InChIKey | CYUVAXXVNMLOKG-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CCC2=NOC(=C2)N |
Computed by PubChem (NCBI)