CAS 1039912-70-3 appears in our catalog under these names: 4-Amino-6-chlorothiochromane 1,1-dioxide, 95%, 6-chloro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-chloro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine (CAS 1039912-70-3) is a chemical compound with the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. IUPAC name: 6-chloro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine. InChIKey: RCXZIISFWJVMFA-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2S |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | 6-chloro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
| InChIKey | RCXZIISFWJVMFA-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C(C1N)C=C(C=C2)Cl |
Computed by PubChem (NCBI)