Products 19920-11-7
CAS 19920-11-7 is the registry number for 1-(4-Chlorophenyl)-1,3-dihydro-2H-benzo[d]imidazol-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-chlorophenyl)-1H-benzimidazol-2-one (CAS 19920-11-7) is a chemical compound with the molecular formula C13H9ClN2O and a molecular weight of 244.67 g/mol. IUPAC name: 3-(4-chlorophenyl)-1H-benzimidazol-2-one. InChIKey: BOXURPJZEYMGEC-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1H-benzimidazol-2-one |
| InChIKey | BOXURPJZEYMGEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)N2C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)