CAS 848361-00-2 appears in our catalog under these names: 2-Pyridinamine, 5-bromo-6-ethyl-3-nitro-, 95%, 5-Bromo-6-ethyl-3-nitro-2-pyridinamine, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g, 5g, 10g.
5-bromo-6-ethyl-3-nitropyridin-2-amine (CAS 848361-00-2) is a chemical compound with the molecular formula C7H8BrN3O2 and a molecular weight of 246.06 g/mol. IUPAC name: 5-bromo-6-ethyl-3-nitropyridin-2-amine. InChIKey: VWPDZMUQRAGOQK-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O2 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 5-bromo-6-ethyl-3-nitropyridin-2-amine |
| InChIKey | VWPDZMUQRAGOQK-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C(=N1)N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)