Products 923163-02-4
CAS 923163-02-4 is the registry number for N'-Acetyl-4-bromo-1H-pyrrole-2-carbohydrazide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N'-acetyl-4-bromo-1H-pyrrole-2-carbohydrazide (CAS 923163-02-4) is a chemical compound with the molecular formula C7H8BrN3O2 and a molecular weight of 246.06 g/mol. IUPAC name: N'-acetyl-4-bromo-1H-pyrrole-2-carbohydrazide. InChIKey: UXTNCPMOOJGHFC-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O2 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | N'-acetyl-4-bromo-1H-pyrrole-2-carbohydrazide |
| InChIKey | UXTNCPMOOJGHFC-UHFFFAOYSA-N |
| SMILES | CC(=O)NNC(=O)C1=CC(=CN1)Br |
Computed by PubChem (NCBI)