CAS 104115-67-5 appears in our catalog under these names: 3-(2-Bromophenyl)pentanedioic acid, 98%, 3-(2-Bromophenyl)pentanedioic acid, 3-(2-Bromophenyl)pentanedioic acid, 97%, 97%, 3-(2-Bromophenyl)pentanedioic acid, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g, 2.5g.
3-(2-bromophenyl)pentanedioic acid (CAS 104115-67-5) is a chemical compound with the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. IUPAC name: 3-(2-bromophenyl)pentanedioic acid. InChIKey: ZVIDNIAPUGGGFR-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO4 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | 3-(2-bromophenyl)pentanedioic acid |
| InChIKey | ZVIDNIAPUGGGFR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CC(=O)O)CC(=O)O)Br |
Computed by PubChem (NCBI)