Products 1043062-36-7
CAS 1043062-36-7 is the registry number for 5-Bromo-N-((4-methylthiazol-2-yl)methyl)furan-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]furan-2-carboxamide (CAS 1043062-36-7) is a chemical compound with the molecular formula C10H9BrN2O2S and a molecular weight of 301.16 g/mol. IUPAC name: 5-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]furan-2-carboxamide. InChIKey: XTWFKPJKIYEJMM-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2S |
|---|---|
| Molecular weight | 301.16 g/mol |
| IUPAC name | 5-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]furan-2-carboxamide |
| InChIKey | XTWFKPJKIYEJMM-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)CNC(=O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)