Products 2248181-61-3
CAS 2248181-61-3 is the registry number for Ethyl 5-(5-bromothiophen-2-yl)-1h-pyrazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 100mg, 1g.
Ethyl 5-(5-bromothiophen-2-yl)-1H-pyrazole-3-carboxylate (CAS 2248181-61-3) is a chemical compound with the molecular formula C10H9BrN2O2S and a molecular weight of 301.16 g/mol. IUPAC name: ethyl 5-(5-bromothiophen-2-yl)-1H-pyrazole-3-carboxylate. InChIKey: NPOMLOPZUYNICW-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2S |
|---|---|
| Molecular weight | 301.16 g/mol |
| IUPAC name | ethyl 5-(5-bromothiophen-2-yl)-1H-pyrazole-3-carboxylate |
| InChIKey | NPOMLOPZUYNICW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NNC(=C1)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)