CAS 1603015-44-6 is the registry number for 3-Bromo-5-(3,4-dimethoxyphenyl)-1,2,4-thiadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5-(3,4-dimethoxyphenyl)-1,2,4-thiadiazole (CAS 1603015-44-6) is a chemical compound with the molecular formula C10H9BrN2O2S and a molecular weight of 301.16 g/mol. IUPAC name: 3-bromo-5-(3,4-dimethoxyphenyl)-1,2,4-thiadiazole. InChIKey: VQEHSQQFNIUIMA-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2S |
|---|---|
| Molecular weight | 301.16 g/mol |
| IUPAC name | 3-bromo-5-(3,4-dimethoxyphenyl)-1,2,4-thiadiazole |
| InChIKey | VQEHSQQFNIUIMA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC(=NS2)Br)OC |
Computed by PubChem (NCBI)