CAS 615534-48-0 is the registry number for 4-Bromo-1-(toluene-4-sulfonyl)-1h-imidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-bromo-1-(4-methylphenyl)sulfonylimidazole (CAS 615534-48-0) is a chemical compound with the molecular formula C10H9BrN2O2S and a molecular weight of 301.16 g/mol. IUPAC name: 4-bromo-1-(4-methylphenyl)sulfonylimidazole. InChIKey: VHRKCNGAIKLPFR-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2S |
|---|---|
| Molecular weight | 301.16 g/mol |
| IUPAC name | 4-bromo-1-(4-methylphenyl)sulfonylimidazole |
| InChIKey | VHRKCNGAIKLPFR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(N=C2)Br |
Computed by PubChem (NCBI)