CAS 116228-41-2 appears in our catalog under these names: 4–Bromo–1–Tosyl–1H–Pyrazole, 4-Bromo-1-tosyl-1H-pyrazole 98%, 4-Bromo-1-tosyl-1H-pyrazole, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
4-bromo-1-(4-methylphenyl)sulfonylpyrazole (CAS 116228-41-2) is a chemical compound with the molecular formula C10H9BrN2O2S and a molecular weight of 301.16 g/mol. IUPAC name: 4-bromo-1-(4-methylphenyl)sulfonylpyrazole. InChIKey: XRKOINRPMVFMFN-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2S |
|---|---|
| Molecular weight | 301.16 g/mol |
| IUPAC name | 4-bromo-1-(4-methylphenyl)sulfonylpyrazole |
| InChIKey | XRKOINRPMVFMFN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C=N2)Br |
Computed by PubChem (NCBI)