CAS 2891458-13-0 is the registry number for Ethyl 5-amino-6-bromothieno[3,2-b]pyridine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-amino-6-bromothieno[3,2-b]pyridine-2-carboxylate (CAS 2891458-13-0) is a chemical compound with the molecular formula C10H9BrN2O2S and a molecular weight of 301.16 g/mol. IUPAC name: ethyl 5-amino-6-bromothieno[3,2-b]pyridine-2-carboxylate. InChIKey: FLISNXGVOWXSCL-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2S |
|---|---|
| Molecular weight | 301.16 g/mol |
| IUPAC name | ethyl 5-amino-6-bromothieno[3,2-b]pyridine-2-carboxylate |
| InChIKey | FLISNXGVOWXSCL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=NC(=C(C=C2S1)Br)N |
Computed by PubChem (NCBI)