CAS 98946-80-6 is the registry number for 2-Bromo-n-(6-methoxy-1,3-benzothiazol-2-yl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-bromo-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide (CAS 98946-80-6) is a chemical compound with the molecular formula C10H9BrN2O2S and a molecular weight of 301.16 g/mol. IUPAC name: 2-bromo-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide. InChIKey: SBVGQBAOBZZYLD-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2S |
|---|---|
| Molecular weight | 301.16 g/mol |
| IUPAC name | 2-bromo-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide |
| InChIKey | SBVGQBAOBZZYLD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(S2)NC(=O)CBr |
Computed by PubChem (NCBI)