CAS 104315-56-2 appears in our catalog under these names: 3-Methoxybenzofuran-2-carboxylic acid, 98%, 3-Methoxy-1-benzofuran-2-carboxylic acid, 3-Methoxy-1-benzofuran-2-carboxylic acid, 95%. Offered by: AmBeed, Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 50mg, 250mg, 1g.
3-methoxy-1-benzofuran-2-carboxylic acid (CAS 104315-56-2) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 3-methoxy-1-benzofuran-2-carboxylic acid. InChIKey: MZOCFIBSONGMJF-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 3-methoxy-1-benzofuran-2-carboxylic acid |
| InChIKey | MZOCFIBSONGMJF-UHFFFAOYSA-N |
| SMILES | COC1=C(OC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)