CAS 1047620-81-4 is the registry number for (2-Phenyl-1,3-thiazol-5-yl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2-phenyl-1,3-thiazol-5-yl)methanamine;hydrochloride (CAS 1047620-81-4) is a chemical compound with the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. IUPAC name: (2-phenyl-1,3-thiazol-5-yl)methanamine;hydrochloride. InChIKey: ZDQWBKSBVOECEI-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | (2-phenyl-1,3-thiazol-5-yl)methanamine;hydrochloride |
| InChIKey | ZDQWBKSBVOECEI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(S2)CN.Cl |
Computed by PubChem (NCBI)