CAS 1443424-64-3 appears in our catalog under these names: (4-Phenyl-1,3-thiazol-2-yl)methanamine hydrochloride, 95%, 4-Phenyl-2-thiazolemethanamine Hydrochloride, (4-Phenylthiazol-2-yl)methanamine hydrochloride, 96%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 1g, 2,5g, 25g.
(4-phenyl-1,3-thiazol-2-yl)methanamine;hydrochloride (CAS 1443424-64-3) is a chemical compound with the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. IUPAC name: (4-phenyl-1,3-thiazol-2-yl)methanamine;hydrochloride. InChIKey: ZWKCELLWMIJOLL-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | (4-phenyl-1,3-thiazol-2-yl)methanamine;hydrochloride |
| InChIKey | ZWKCELLWMIJOLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)CN.Cl |
Computed by PubChem (NCBI)