CAS 1461714-51-1 appears in our catalog under these names: 2-Methyl-5-phenyl-1,3-thiazol-4-amine hydrochloride, 95%, 2-Methyl-5-phenyl-1,3-thiazol-4-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methyl-5-phenyl-1,3-thiazol-4-amine;hydrochloride (CAS 1461714-51-1) is a chemical compound with the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. IUPAC name: 2-methyl-5-phenyl-1,3-thiazol-4-amine;hydrochloride. InChIKey: JZECRBNQRSGPFD-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | 2-methyl-5-phenyl-1,3-thiazol-4-amine;hydrochloride |
| InChIKey | JZECRBNQRSGPFD-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)