CAS 439693-52-4 appears in our catalog under these names: 6-tert-Butyl-4-chlorothieno[3,2-d]pyrimidine, 95%, 6-(tert-Butyl)-4-chlorothieno[3,2-d]pyrimidine 97%, 6-(tert-Butyl)-4-chlorothieno[3,2-d]pyrimidine, 97%, 97%, 6-t-Butyl-4-chlorothieno[3,2-d]pyrimidine, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 25g.
6-tert-butyl-4-chlorothieno[3,2-d]pyrimidine (CAS 439693-52-4) is a chemical compound with the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. IUPAC name: 6-tert-butyl-4-chlorothieno[3,2-d]pyrimidine. InChIKey: HRULXTDXJYTJPU-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | 6-tert-butyl-4-chlorothieno[3,2-d]pyrimidine |
| InChIKey | HRULXTDXJYTJPU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(S1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)