CAS 91818-69-8 appears in our catalog under these names: (4-Phenylthiazol-2-yl)methanamine dihydrochloride, 98%, 4-Phenyl-thiazol-2-yl-methylamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 50mg, 1g, 10g.
(4-phenyl-1,3-thiazol-2-yl)methanamine;hydrochloride (CAS 91818-69-8) is a chemical compound with the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. IUPAC name: (4-phenyl-1,3-thiazol-2-yl)methanamine;hydrochloride. InChIKey: ZWKCELLWMIJOLL-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | (4-phenyl-1,3-thiazol-2-yl)methanamine;hydrochloride |
| InChIKey | ZWKCELLWMIJOLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)CN.Cl |
Computed by PubChem (NCBI)