Products 39912-61-3

CAS 39912-61-3 is the registry number for 3-Benzyl-1,3-thiazol-2(3h)-imine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-benzyl-1,3-thiazol-2-imine;hydrochloride (CAS 39912-61-3) is a chemical compound with the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. IUPAC name: 3-benzyl-1,3-thiazol-2-imine;hydrochloride. InChIKey: MVUPICKBYJNSEN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClN2S
Molecular weight226.73 g/mol
IUPAC name3-benzyl-1,3-thiazol-2-imine;hydrochloride
InChIKeyMVUPICKBYJNSEN-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CN2C=CSC2=N.Cl

Computed by PubChem (NCBI)