CAS 39912-61-3 is the registry number for 3-Benzyl-1,3-thiazol-2(3h)-imine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-benzyl-1,3-thiazol-2-imine;hydrochloride (CAS 39912-61-3) is a chemical compound with the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. IUPAC name: 3-benzyl-1,3-thiazol-2-imine;hydrochloride. InChIKey: MVUPICKBYJNSEN-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | 3-benzyl-1,3-thiazol-2-imine;hydrochloride |
| InChIKey | MVUPICKBYJNSEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CSC2=N.Cl |
Computed by PubChem (NCBI)