CAS 857997-89-8 is the registry number for (2-Phenyl-1,3-thiazol-4-yl)methanamine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 5g, 10g, 1g.
(2-phenyl-1,3-thiazol-4-yl)methanamine;hydrochloride (CAS 857997-89-8) is a chemical compound with the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. IUPAC name: (2-phenyl-1,3-thiazol-4-yl)methanamine;hydrochloride. InChIKey: NRSFWQQBOWQTGN-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | (2-phenyl-1,3-thiazol-4-yl)methanamine;hydrochloride |
| InChIKey | NRSFWQQBOWQTGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)CN.Cl |
Computed by PubChem (NCBI)