CAS 104839-39-6 is the registry number for 10-Monohydroxy Oxcarbazepine. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dihydroxybenzo[b][1]benzazepine-11-carboxamide (CAS 104839-39-6) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 5,6-dihydroxybenzo[b][1]benzazepine-11-carboxamide. InChIKey: ZDQLVKTWIHTZOE-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 5,6-dihydroxybenzo[b][1]benzazepine-11-carboxamide |
| InChIKey | ZDQLVKTWIHTZOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C3=CC=CC=C3N2C(=O)N)O)O |
Computed by PubChem (NCBI)