Products 1048914-02-8
CAS 1048914-02-8 is the registry number for 2-Amino-3-ethynyl-5-(trifluoromethyl)pyridine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-ethynyl-5-(trifluoromethyl)pyridin-2-amine (CAS 1048914-02-8) is a chemical compound with the molecular formula C8H5F3N2 and a molecular weight of 186.13 g/mol. IUPAC name: 3-ethynyl-5-(trifluoromethyl)pyridin-2-amine. InChIKey: AOXNOOYKQDKKFU-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2 |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | 3-ethynyl-5-(trifluoromethyl)pyridin-2-amine |
| InChIKey | AOXNOOYKQDKKFU-UHFFFAOYSA-N |
| SMILES | C#CC1=C(N=CC(=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)