CAS 1049032-01-0 appears in our catalog under these names: (4-[5-(2-Furyl)-1h-1,2,4-triazol-3-yl]phenyl)amine, 95%, Benzenamine, 4-(5-(2-furanyl)-1H-1,2,4-triazol-3-yl)-, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]aniline (CAS 1049032-01-0) is a chemical compound with the molecular formula C12H10N4O and a molecular weight of 226.23 g/mol. IUPAC name: 4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]aniline. InChIKey: LTHPIFUITZWNGM-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]aniline |
| InChIKey | LTHPIFUITZWNGM-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NC(=NN2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)