CAS 287980-84-1 appears in our catalog under these names: Nevirapine EP Impurity B, BIRG 616 BS. Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 250mg, 25mg, 100mg, 5mg, 10mg.
7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one (CAS 287980-84-1) is a chemical compound with the molecular formula C12H10N4O and a molecular weight of 226.23 g/mol. IUPAC name: 7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one. InChIKey: RKCRKBSFEVQVSX-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one |
| InChIKey | RKCRKBSFEVQVSX-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC=C1)NC3=C(C=CC=N3)C(=O)N2 |
Computed by PubChem (NCBI)