CAS 91974-63-9 appears in our catalog under these names: 6-Methyl-1-phenyl-1,5-dihydro-4h-pyrazolo[3,4-d]pyrimidin-4-one, 95%, 6-Methyl-1-phenyl-1H-pyrazolo(3,4-d)pyrimidin-4(5H)-one, 98%, 6-Methyl-1-phenyl-1,5-dihydro-4{H}-pyrazolo(3,4-{D})pyrimidin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 2,5g.
6-methyl-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 91974-63-9) is a chemical compound with the molecular formula C12H10N4O and a molecular weight of 226.23 g/mol. IUPAC name: 6-methyl-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: IBHIMSDXHPVZAG-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 6-methyl-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | IBHIMSDXHPVZAG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=NN2C3=CC=CC=C3)C(=O)N1 |
Computed by PubChem (NCBI)