CAS 565165-42-6 appears in our catalog under these names: 3-(2,3-Dihydro-1,3a,8-triaza-cyclopenta[a]inden-1-yl)-3-oxo-propionitrile, 95%, 3-Oxo-3-{2,5,7-triazatricyclo(6.4.0.0,2,6)dodeca-1(12),6,8,10-tetraen-5-yl}propanenitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)-3-oxopropanenitrile (CAS 565165-42-6) is a chemical compound with the molecular formula C12H10N4O and a molecular weight of 226.23 g/mol. IUPAC name: 3-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)-3-oxopropanenitrile. InChIKey: DHFPOUMOBYUWJQ-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)-3-oxopropanenitrile |
| InChIKey | DHFPOUMOBYUWJQ-UHFFFAOYSA-N |
| SMILES | C1CN(C2=NC3=CC=CC=C3N21)C(=O)CC#N |
Computed by PubChem (NCBI)