CAS 35877-37-3 appears in our catalog under these names: 1-Benzyl-1h-pyrazolo[3,4-d]pyrimidin-4-ol, 95%, 1-benzyl-1H-pyrazolo(3,4-d)pyrimidin-4-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
1-benzyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 35877-37-3) is a chemical compound with the molecular formula C12H10N4O and a molecular weight of 226.23 g/mol. IUPAC name: 1-benzyl-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: ASCMRDPFTNELIK-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 1-benzyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | ASCMRDPFTNELIK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=N2)C(=O)NC=N3 |
Computed by PubChem (NCBI)