CAS 54738-75-9 appears in our catalog under these names: 1-(4-Methylphenyl)-1h,4h,5h-pyrazolo[3,4-d]pyrimidin-4-one, 95%, 1-(p-Tolyl)-1,5-dihydro-4H-pyrazolo(3,4-d)pyrimidin-4-one, 95%, 1-(4-Methylphenyl)-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 2,5g.
1-(4-methylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 54738-75-9) is a chemical compound with the molecular formula C12H10N4O and a molecular weight of 226.23 g/mol. IUPAC name: 1-(4-methylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: OUNSZGRPBAHKHX-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 1-(4-methylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | OUNSZGRPBAHKHX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C3=C(C=N2)C(=O)NC=N3 |
Computed by PubChem (NCBI)