CAS 148672-80-4 appears in our catalog under these names: 3-(1H-Imidazol-1-ylcarbonyl)-1-methyl-1h-indazole, 90%, 3-(1H-Imidazol-1-ylcarbonyl)-1-methyl-1H-indazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 1000mg, 5000mg.
Imidazol-1-yl-(1-methylindazol-3-yl)methanone (CAS 148672-80-4) is a chemical compound with the molecular formula C12H10N4O and a molecular weight of 226.23 g/mol. IUPAC name: imidazol-1-yl-(1-methylindazol-3-yl)methanone. InChIKey: ACWOWQOLWCGQCZ-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | imidazol-1-yl-(1-methylindazol-3-yl)methanone |
| InChIKey | ACWOWQOLWCGQCZ-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=N1)C(=O)N3C=CN=C3 |
Computed by PubChem (NCBI)