CAS 1049130-00-8 appears in our catalog under these names: 1-(3-Chlorophenyl)-1H-1,2,3-triazole-5-carboxylic acid, 95%, 1-(3-Chlorophenyl)-1H-1,2,3-triazole-5-carboxylic acid, 98%, 98%, 1-(3-Chlorophenyl)-1H-1,2,3-triazole-5-carboxylic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
3-(3-chlorophenyl)triazole-4-carboxylic acid (CAS 1049130-00-8) is a chemical compound with the molecular formula C9H6ClN3O2 and a molecular weight of 223.61 g/mol. IUPAC name: 3-(3-chlorophenyl)triazole-4-carboxylic acid. InChIKey: MKBLZHIIBOOVPP-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O2 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 3-(3-chlorophenyl)triazole-4-carboxylic acid |
| InChIKey | MKBLZHIIBOOVPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C(=CN=N2)C(=O)O |
Computed by PubChem (NCBI)