Products 2691878-64-3
CAS 2691878-64-3 is the registry number for 2-Amino-3-chloro-1,7-naphthyridine-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-3-chloro-1,7-naphthyridine-6-carboxylic acid (CAS 2691878-64-3) is a chemical compound with the molecular formula C9H6ClN3O2 and a molecular weight of 223.61 g/mol. IUPAC name: 2-amino-3-chloro-1,7-naphthyridine-6-carboxylic acid. InChIKey: JOYZZXVBJGKJRR-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O2 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 2-amino-3-chloro-1,7-naphthyridine-6-carboxylic acid |
| InChIKey | JOYZZXVBJGKJRR-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(N=CC2=NC(=C1Cl)N)C(=O)O |
Computed by PubChem (NCBI)