CAS 1279219-17-8 appears in our catalog under these names: 2-(5-Chloro-1h-1,2,4-triazol-3-yl)benzoic acid, 95%, 2-(5-Chloro-1H-1,2,4-triazol-3-yl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoic acid (CAS 1279219-17-8) is a chemical compound with the molecular formula C9H6ClN3O2 and a molecular weight of 223.61 g/mol. IUPAC name: 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoic acid. InChIKey: QBDVXAISXBSKGK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O2 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoic acid |
| InChIKey | QBDVXAISXBSKGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=N2)Cl)C(=O)O |
Computed by PubChem (NCBI)