CAS 1220039-65-5 is the registry number for Methyl 4-chloropyrido(3,4-d)pyrimidine-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-chloropyrido[3,4-d]pyrimidine-2-carboxylate (CAS 1220039-65-5) is a chemical compound with the molecular formula C9H6ClN3O2 and a molecular weight of 223.61 g/mol. IUPAC name: methyl 4-chloropyrido[3,4-d]pyrimidine-2-carboxylate. InChIKey: ZYOTXZCWBGAGRH-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O2 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | methyl 4-chloropyrido[3,4-d]pyrimidine-2-carboxylate |
| InChIKey | ZYOTXZCWBGAGRH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(C=CN=C2)C(=N1)Cl |
Computed by PubChem (NCBI)