CAS 878724-46-0 is the registry number for 4-Chloro-2-(4H-1,2,4-triazol-4-yl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-2-(1,2,4-triazol-4-yl)benzoic acid (CAS 878724-46-0) is a chemical compound with the molecular formula C9H6ClN3O2 and a molecular weight of 223.61 g/mol. IUPAC name: 4-chloro-2-(1,2,4-triazol-4-yl)benzoic acid. InChIKey: DSTSETFZHGAIID-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O2 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 4-chloro-2-(1,2,4-triazol-4-yl)benzoic acid |
| InChIKey | DSTSETFZHGAIID-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)N2C=NN=C2)C(=O)O |
Computed by PubChem (NCBI)