CAS 2691878-59-6 is the registry number for 7-Amino-6-chloro-1,8-naphthyridine-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-amino-6-chloro-1,8-naphthyridine-3-carboxylic acid (CAS 2691878-59-6) is a chemical compound with the molecular formula C9H6ClN3O2 and a molecular weight of 223.61 g/mol. IUPAC name: 7-amino-6-chloro-1,8-naphthyridine-3-carboxylic acid. InChIKey: YNUPCLKONVOZPS-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O2 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 7-amino-6-chloro-1,8-naphthyridine-3-carboxylic acid |
| InChIKey | YNUPCLKONVOZPS-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C(=NC2=NC=C1C(=O)O)N)Cl |
Computed by PubChem (NCBI)