CAS 161373-46-2 appears in our catalog under these names: 3-Cinnolinecarboxylic acid, 4-amino-6-chloro-, 95%, 4–Amino–6–chlorocinnoline–3–carboxylic acid, 4-Amino-6-chlorocinnoline-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-amino-6-chlorocinnoline-3-carboxylic acid (CAS 161373-46-2) is a chemical compound with the molecular formula C9H6ClN3O2 and a molecular weight of 223.61 g/mol. IUPAC name: 4-amino-6-chlorocinnoline-3-carboxylic acid. InChIKey: HAKAGWNOVFLFAZ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O2 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 4-amino-6-chlorocinnoline-3-carboxylic acid |
| InChIKey | HAKAGWNOVFLFAZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=C(N=N2)C(=O)O)N |
Computed by PubChem (NCBI)