CAS 629655-19-2 appears in our catalog under these names: 5-Chloro-2-(1H-1,2,4-triazol-1-yl)benzoic acid, 95%, 5-Chloro-2-(1H-1,2,4-triazol-1-yl)benzoic acid, 5-Chloro-2-(1H-1,2,4-triazol-1-yl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 100mg, 1g.
5-chloro-2-(1,2,4-triazol-1-yl)benzoic acid (CAS 629655-19-2) is a chemical compound with the molecular formula C9H6ClN3O2 and a molecular weight of 223.61 g/mol. IUPAC name: 5-chloro-2-(1,2,4-triazol-1-yl)benzoic acid. InChIKey: OZGSJCVAEWACOE-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O2 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 5-chloro-2-(1,2,4-triazol-1-yl)benzoic acid |
| InChIKey | OZGSJCVAEWACOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)O)N2C=NC=N2 |
Computed by PubChem (NCBI)