CAS 1049131-86-3 appears in our catalog under these names: 3-(3-Bromophenyl)aniline, 3-(3-Bromophenyl)aniline, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 10g.
3-(3-bromophenyl)aniline (CAS 1049131-86-3) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 3-(3-bromophenyl)aniline. InChIKey: OSBMEJLVNAQEIN-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 3-(3-bromophenyl)aniline |
| InChIKey | OSBMEJLVNAQEIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)