CAS 1049677-82-8 appears in our catalog under these names: Methyl 1-Boc-6-amino-indole-2-carboxylate, 95%, Methyl 1-boc-6-amino-indole-2-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 5000mg.
1-O-tert-butyl 2-O-methyl 6-aminoindole-1,2-dicarboxylate (CAS 1049677-82-8) is a chemical compound with the molecular formula C15H18N2O4 and a molecular weight of 290.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 6-aminoindole-1,2-dicarboxylate. InChIKey: NKGLAIWBDIJLNH-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O4 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 6-aminoindole-1,2-dicarboxylate |
| InChIKey | NKGLAIWBDIJLNH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(=CC2=C1C=C(C=C2)N)C(=O)OC |
Computed by PubChem (NCBI)