Products 1049727-79-8

CAS 1049727-79-8 is the registry number for (3S,4R)-4-(4-Chlorophenyl) pyrrolidine-3-carboxylic acid Hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1049727-79-8) is a chemical compound with the molecular formula C11H13Cl2NO2 and a molecular weight of 262.13 g/mol. IUPAC name: (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: OIMCKZOWSJOMID-BAUSSPIASA-N.

Identity
Molecular formulaC11H13Cl2NO2
Molecular weight262.13 g/mol
IUPAC name(3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride
InChIKeyOIMCKZOWSJOMID-BAUSSPIASA-N
SMILESC1[C@H]([C@@H](CN1)C(=O)O)C2=CC=C(C=C2)Cl.Cl

Computed by PubChem (NCBI)