CAS 2350009-69-5 is the registry number for (S)-2-Amino-5-(3,5-dichlorophenyl)pentanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-5-(3,5-dichlorophenyl)pentanoic acid (CAS 2350009-69-5) is a chemical compound with the molecular formula C11H13Cl2NO2 and a molecular weight of 262.13 g/mol. IUPAC name: (2S)-2-amino-5-(3,5-dichlorophenyl)pentanoic acid. InChIKey: ZUXUMXVGGUQARX-JTQLQIEISA-N.
| Molecular formula | C11H13Cl2NO2 |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | (2S)-2-amino-5-(3,5-dichlorophenyl)pentanoic acid |
| InChIKey | ZUXUMXVGGUQARX-JTQLQIEISA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)CCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)